ChemNet > CAS > 95-63-6 1,2,4-Trimethylbenzene
95-63-6 1,2,4-Trimethylbenzene
| 상품명칭 |
1,2,4-Trimethylbenzene |
| 별명 |
Pseudocumene; 1,2,4-Trimethylbenzere; 1,3,4-Trimethylbenzene |
| 분자식 |
C9H12 |
| 분자량 |
120.19 |
| InChI |
InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
| cas번호 |
95-63-6 |
| EC번호 |
202-436-9 |
| 분자 구조 |
|
| 밀도 |
0.88 |
| 녹는 점 |
-44℃ |
| 비등점 |
168℃ |
| 굴절 지수 |
1.503-1.505 |
| 인화점 |
48℃ |
| 위험성 표시 |
 Xn:Harmful;
 N:Dangerous for the environment;
|
| 리스크 규칙 |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
