ChemNet > CAS > 954-81-4 N-(5-Bromopentyl)phthalimide
954-81-4 N-(5-Bromopentyl)phthalimide
| 상품명칭 |
N-(5-Bromopentyl)phthalimide |
| 별명 |
2-(5-bromopentyl)-1H-isoindole-1,3(2H)-dione |
| 분자식 |
C13H14BrNO2 |
| 분자량 |
296.1598 |
| InChI |
InChI=1/C13H14BrNO2/c14-8-4-1-5-9-15-12(16)10-6-2-3-7-11(10)13(15)17/h2-3,6-7H,1,4-5,8-9H2 |
| cas번호 |
954-81-4 |
| 분자 구조 |
|
| 밀도 |
1.459g/cm3 |
| 비등점 |
393.1°C at 760 mmHg |
| 굴절 지수 |
1.591 |
| 인화점 |
191.5°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
