ChemNet > CAS > 95727-77-8 2,6-Difluorobutyrophenone
95727-77-8 2,6-Difluorobutyrophenone
| 상품명칭 |
2,6-Difluorobutyrophenone |
| 별명 |
1-(2,6-difluorophenyl)butan-1-one |
| 분자식 |
C10H10F2O |
| 분자량 |
184.1826 |
| InChI |
InChI=1/C10H10F2O/c1-2-4-9(13)10-7(11)5-3-6-8(10)12/h3,5-6H,2,4H2,1H3 |
| cas번호 |
95727-77-8 |
| 분자 구조 |
|
| 밀도 |
1.134g/cm3 |
| 비등점 |
219.6°C at 760 mmHg |
| 굴절 지수 |
1.472 |
| 인화점 |
82.6°C |
| 위험성 표시 |
|
| 리스크 규칙 |
R36/38:Irritating to eyes and skin.;
|
| 보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
