ChemNet > CAS > 959-28-4 trans-1,2-Dibenzoylethylene
959-28-4 trans-1,2-Dibenzoylethylene
상품명칭 |
trans-1,2-Dibenzoylethylene |
별명 |
trans-1,4-Diphenyl-2-butene-1,4-dione; 1,2-Dibenzoylethylene, perdominantly trans, (trans-1,4-Diphenyl-2-butene-1,4-dione); (2E)-1,4-diphenylbut-2-ene-1,4-dione |
분자식 |
C16H12O2 |
분자량 |
236.2653 |
InChI |
InChI=1/C16H12O2/c17-15(13-7-3-1-4-8-13)11-12-16(18)14-9-5-2-6-10-14/h1-12H/b12-11+ |
cas번호 |
959-28-4 |
EC번호 |
213-498-1 |
분자 구조 |
|
밀도 |
1.141g/cm3 |
녹는 점 |
108-112℃ |
비등점 |
368.5°C at 760 mmHg |
굴절 지수 |
1.597 |
인화점 |
138.2°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|