ChemNet > CAS > 96-04-8 2,3-heptanedione
96-04-8 2,3-heptanedione
상품명칭 |
2,3-heptanedione |
별명 |
2,3-Heptanedione; Acetyl pentanoyl; Acetyl valeryl; FEMA No. 2543; NSC 31668; UNII-DK55DDE86P; Valerylacetyl; heptane-2,3-dione |
분자식 |
C7H12O2 |
분자량 |
128.169 |
InChI |
InChI=1/C7H12O2/c1-3-4-5-7(9)6(2)8/h3-5H2,1-2H3 |
cas번호 |
96-04-8 |
EC번호 |
202-472-5 |
분자 구조 |
|
밀도 |
0.926g/cm3 |
비등점 |
149.7°C at 760 mmHg |
굴절 지수 |
1.413 |
인화점 |
45°C |
위험성 표시 |
|
리스크 규칙 |
R10:Flammable.;
|
보안 규칙 |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|