ChemNet > CAS > 98555-71-6 5-(2,5-Dichlorophenyl)-1H-tetrazole
98555-71-6 5-(2,5-Dichlorophenyl)-1H-tetrazole
상품명칭 |
5-(2,5-Dichlorophenyl)-1H-tetrazole |
별명 |
5-(2,5-dichlorophenyl)-2H-tetrazole |
분자식 |
C7H4Cl2N4 |
분자량 |
215.0395 |
InChI |
InChI=1/C7H4Cl2N4/c8-4-1-2-6(9)5(3-4)7-10-12-13-11-7/h1-3H,(H,10,11,12,13) |
cas번호 |
98555-71-6 |
분자 구조 |
|
밀도 |
1.574g/cm3 |
비등점 |
401.9°C at 760 mmHg |
굴절 지수 |
1.641 |
인화점 |
229.1°C |
위험성 표시 |
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|