ChemNet > CAS > 98919-15-4 1,2-dichloro-4-(2,2-diethoxyethoxy)benzene
98919-15-4 1,2-dichloro-4-(2,2-diethoxyethoxy)benzene
상품명칭 |
1,2-dichloro-4-(2,2-diethoxyethoxy)benzene |
분자식 |
C12H16Cl2O3 |
분자량 |
279.1596 |
InChI |
InChI=1/C12H16Cl2O3/c1-3-15-12(16-4-2)8-17-9-5-6-10(13)11(14)7-9/h5-7,12H,3-4,8H2,1-2H3 |
cas번호 |
98919-15-4 |
분자 구조 |
|
밀도 |
1.198g/cm3 |
비등점 |
352.1°C at 760 mmHg |
굴절 지수 |
1.507 |
인화점 |
123.6°C |
위험성 표시 |
Xi:Irritant;
|
리스크 규칙 |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
보안 규칙 |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|