ChemNet > CAS > 99-21-8 N-(4-amino-5-methoxy-2-methylphenyl)benzamide
99-21-8 N-(4-amino-5-methoxy-2-methylphenyl)benzamide
상품명칭 |
N-(4-amino-5-methoxy-2-methylphenyl)benzamide |
별명 |
Benzamide, N-(4-amino-5-methoxy-2-methylphenyl)-; 4'-Amino-5'-methoxy-2'-methylbenzanilide; 4-amino-5-methoxy-2-methyl-N-phenylbenzamide; Fast Violet Base B; FAST VIOLER B BASE |
분자식 |
C15H16N2O2 |
분자량 |
256.2997 |
InChI |
InChI=1/C15H16N2O2/c1-10-8-13(16)14(19-2)9-12(10)15(18)17-11-6-4-3-5-7-11/h3-9H,16H2,1-2H3,(H,17,18) |
cas번호 |
99-21-8 |
EC번호 |
202-740-1 |
분자 구조 |
|
밀도 |
1.215g/cm3 |
녹는 점 |
185℃ |
비등점 |
384.7°C at 760 mmHg |
굴절 지수 |
1.646 |
인화점 |
186.5°C |
위험성 표시 |
|
리스크 규칙 |
|
보안 규칙 |
S24/25:Avoid contact with skin and eyes.;
|
|