ChemNet > CAS > 104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
104451-99-2 2-Chloro-6-fluoro-3-methylbenzaldehyde
Nama produk |
2-Chloro-6-fluoro-3-methylbenzaldehyde |
Sinonim |
2-Chloro-6-fluoro-m-tolualdehyde |
MF |
C8H6ClFO |
Berat Molekul |
172.584 |
InChI |
InChI=1/C8H6ClFO/c1-5-2-3-7(10)6(4-11)8(5)9/h2-4H,1H3 |
CAS NO |
104451-99-2 |
Struktur Molekul |
|
Kepadatan |
1.292g/cm3 |
Titik lebur |
30-33℃ |
Titik didih |
225.1°C at 760 mmHg |
Indeks bias |
1.552 |
Titik nyala |
89.9°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|