ChemNet > CAS > 111373-03-6 Cyanophenylpiperazine
111373-03-6 Cyanophenylpiperazine
| Nama produk |
Cyanophenylpiperazine |
| Sinonim |
1-(2-Cyanophenyl)piperazine; 2-(1-Piperazino)benzonitrile; 2-piperazin-1-ylbenzonitrile |
| MF |
C11H13N3 |
| Berat Molekul |
187.241 |
| InChI |
InChI=1/C11H13N3/c12-9-10-3-1-2-4-11(10)14-7-5-13-6-8-14/h1-4,13H,5-8H2 |
| CAS NO |
111373-03-6 |
| Struktur Molekul |
|
| Kepadatan |
1.16g/cm3 |
| Titik didih |
369.4°C at 760 mmHg |
| Indeks bias |
1.602 |
| Titik nyala |
177.2°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
