ChemNet > CAS > 1124-39-6 4-Ethylcatechol
1124-39-6 4-Ethylcatechol
Nama produk |
4-Ethylcatechol |
Sinonim |
3,4-Dihydroxyethylbenzene; 4-ethylbenzene-1,2-diol |
MF |
C8H10O2 |
Berat Molekul |
138.1638 |
InChI |
InChI=1/C8H10O2/c1-2-6-3-4-7(9)8(10)5-6/h3-5,9-10H,2H2,1H3 |
CAS NO |
1124-39-6 |
EINECS |
214-397-5 |
Struktur Molekul |
|
Kepadatan |
1.159g/cm3 |
Titik didih |
273.3°C at 760 mmHg |
Indeks bias |
1.578 |
Titik nyala |
134.1°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|