ChemNet > CAS > 116632-39-4 Bromoiodotoluene
116632-39-4 Bromoiodotoluene
Nama produk |
Bromoiodotoluene |
Sinonim |
5-Bromo-2-iodotoluene; 4-bromo-1-iodo-2-methylbenzene |
MF |
C7H6BrI |
Berat Molekul |
296.931 |
InChI |
InChI=1/C7H6BrI/c1-5-4-6(8)2-3-7(5)9/h2-4H,1H3 |
CAS NO |
116632-39-4 |
Struktur Molekul |
|
Kepadatan |
2.062g/cm3 |
Titik didih |
264.2°C at 760 mmHg |
Indeks bias |
1.636 |
Titik nyala |
113.6°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|