ChemNet > CAS > 1198-37-4 2,4-dimethylquinoline
1198-37-4 2,4-dimethylquinoline
Nama produk |
2,4-dimethylquinoline |
Sinonim |
Dimethylquinoline |
MF |
C11H11N |
Berat Molekul |
157.2117 |
InChI |
InChI=1/C11H11N/c1-8-7-9(2)12-11-6-4-3-5-10(8)11/h3-7H,1-2H3 |
CAS NO |
1198-37-4 |
EINECS |
214-832-9 |
Struktur Molekul |
|
Kepadatan |
1.052g/cm3 |
Titik didih |
263.8°C at 760 mmHg |
Indeks bias |
1.61 |
Titik nyala |
107.6°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|