ChemNet > CAS > 1200-13-1 p-(Tolylthio)acetone
1200-13-1 p-(Tolylthio)acetone
Nama produk |
p-(Tolylthio)acetone |
Sinonim |
(4-Methylphenylthio)acetone; 1-[(4-Methylphenyl)thio]acetone; 1-[(4-methylphenyl)sulfanyl]propan-2-one |
MF |
C10H12OS |
Berat Molekul |
180.2667 |
InChI |
InChI=1/C10H12OS/c1-8-3-5-10(6-4-8)12-7-9(2)11/h3-6H,7H2,1-2H3 |
CAS NO |
1200-13-1 |
Struktur Molekul |
|
Kepadatan |
1.08g/cm3 |
Titik lebur |
96-98℃ |
Titik didih |
267.5°C at 760 mmHg |
Indeks bias |
1.554 |
Titik nyala |
122.1°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|