ChemNet > CAS > 128495-46-5 4-Fluoro-3-methoxybenzaldehyde
128495-46-5 4-Fluoro-3-methoxybenzaldehyde
Nama produk |
4-Fluoro-3-methoxybenzaldehyde |
Sinonim |
4-Fluoro-m-anisaldehyde; 3-Methoxy-4-Fluorobenzaldehyde |
MF |
C8H7FO2 |
Berat Molekul |
154.1384 |
InChI |
InChI=1/C8H7FO2/c1-11-8-4-6(5-10)2-3-7(8)9/h2-5H,1H3 |
CAS NO |
128495-46-5 |
Struktur Molekul |
|
Kepadatan |
1.192g/cm3 |
Titik lebur |
61-63℃ |
Titik didih |
246.3°C at 760 mmHg |
Indeks bias |
1.525 |
Titik nyala |
99.8°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|