ChemNet > CAS > 13194-68-8 4-iodo-2-methylaniline
13194-68-8 4-iodo-2-methylaniline
Nama produk |
4-iodo-2-methylaniline |
Sinonim |
2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
MF |
C7H8IN |
Berat Molekul |
233.0496 |
InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
CAS NO |
13194-68-8 |
EINECS |
236-154-2 |
Struktur Molekul |
|
Kepadatan |
1.791g/cm3 |
Titik lebur |
86-89℃ |
Titik didih |
278.4°C at 760 mmHg |
Indeks bias |
1.663 |
Titik nyala |
122.1°C |
Cinta bahaya |
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|