ChemNet > CAS > 132980-99-5 3,5-difluorobenzamide
132980-99-5 3,5-difluorobenzamide
| Nama produk |
3,5-difluorobenzamide |
| Sinonim |
Difluorobenzamide6 |
| MF |
C7H5F2NO |
| Berat Molekul |
157.1175 |
| InChI |
InChI=1/C7H5F2NO/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H2,10,11) |
| CAS NO |
132980-99-5 |
| Struktur Molekul |
|
| Kepadatan |
1.348g/cm3 |
| Titik lebur |
155-157℃ |
| Titik didih |
187.7°C at 760 mmHg |
| Indeks bias |
1.515 |
| Titik nyala |
67.3°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
