ChemNet > CAS > 13368-86-0 1,2,5-Thiadiazole-3-carboxylic acid
13368-86-0 1,2,5-Thiadiazole-3-carboxylic acid
| Nama produk |
1,2,5-Thiadiazole-3-carboxylic acid |
| MF |
C3H2N2O2S |
| Berat Molekul |
130.1252 |
| InChI |
InChI=1/C3H2N2O2S/c6-3(7)2-1-4-8-5-2/h1H,(H,6,7) |
| CAS NO |
13368-86-0 |
| Struktur Molekul |
|
| Kepadatan |
1.67g/cm3 |
| Titik lebur |
89℃ |
| Titik didih |
292.8°C at 760 mmHg |
| Indeks bias |
1.631 |
| Titik nyala |
130.9°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
