ChemNet > CAS > 135-00-2 2-Benzoylthiophene
135-00-2 2-Benzoylthiophene
Nama produk |
2-Benzoylthiophene |
Sinonim |
2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
MF |
C11H8OS |
Berat Molekul |
188.2456 |
InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
CAS NO |
135-00-2 |
EINECS |
205-169-6 |
Struktur Molekul |
|
Kepadatan |
1.198g/cm3 |
Titik didih |
300°C at 760 mmHg |
Indeks bias |
1.609 |
Titik nyala |
139.7°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|