ChemNet > CAS > 135145-90-3 2,5-Dichlorobenzeneboronic acid
135145-90-3 2,5-Dichlorobenzeneboronic acid
| Nama produk |
2,5-Dichlorobenzeneboronic acid |
| Sinonim |
2,5-Dichlorophenylboronic acid |
| MF |
C6H5BCl2O2 |
| Berat Molekul |
190.8197 |
| InChI |
InChI=1/C6H5BCl2O2/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,10-11H |
| CAS NO |
135145-90-3 |
| Struktur Molekul |
|
| Kepadatan |
1.47g/cm3 |
| Titik lebur |
150℃ |
| Titik didih |
343.6°C at 760 mmHg |
| Indeks bias |
1.577 |
| Titik nyala |
161.6°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
