ChemNet > CAS > 13524-04-4 1-(2-Chlorophenyl)ethanol
13524-04-4 1-(2-Chlorophenyl)ethanol
| Nama produk |
1-(2-Chlorophenyl)ethanol |
| Sinonim |
2-Chloro-alpha-methylbenzyl alcohol; (1S)-1-(2-chlorophenyl)ethanol; (1R)-1-(2-chlorophenyl)ethanol |
| MF |
C8H9ClO |
| Berat Molekul |
156.6095 |
| InChI |
InChI=1/C8H9ClO/c1-6(10)7-4-2-3-5-8(7)9/h2-6,10H,1H3/t6-/m1/s1 |
| CAS NO |
13524-04-4 |
| EINECS |
236-868-4 |
| Struktur Molekul |
|
| Kepadatan |
1.182g/cm3 |
| Titik didih |
231.4°C at 760 mmHg |
| Indeks bias |
1.55 |
| Titik nyala |
93.8°C |
| Cinta bahaya |
|
| Kod Risiko |
|
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|
