ChemNet > CAS > 14113-01-0 Ethylhydrogensuberate, (Monoethylsuberate; Subericacid monoethylester)
14113-01-0 Ethylhydrogensuberate, (Monoethylsuberate; Subericacid monoethylester)
Nama produk |
Ethylhydrogensuberate, (Monoethylsuberate; Subericacid monoethylester) |
Sinonim |
Ethyl hydrogen suberate; Monoethyl suberate~Octanedioic acid monoethyl ester~Suberic acid monoethyl ester; 8-ethoxy-8-oxooctanoic acid |
MF |
C10H18O4 |
Berat Molekul |
202.2475 |
InChI |
InChI=1/C10H18O4/c1-2-14-10(13)8-6-4-3-5-7-9(11)12/h2-8H2,1H3,(H,11,12) |
CAS NO |
14113-01-0 |
EINECS |
237-968-0 |
Struktur Molekul |
|
Kepadatan |
1.054g/cm3 |
Titik didih |
304.7°C at 760 mmHg |
Indeks bias |
1.451 |
Titik nyala |
111.7°C |
Cinta bahaya |
|
Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|