ChemNet > CAS > 145240-28-4 4-n-Butylbenzeneboronic acid
145240-28-4 4-n-Butylbenzeneboronic acid
Nama produk |
4-n-Butylbenzeneboronic acid |
Sinonim |
4-n-Butylphenylboronic acid; 4-Butylphenylboronic acid; (4-butylphenyl)boronic acid |
MF |
C10H15BO2 |
Berat Molekul |
178.0359 |
InChI |
InChI=1/C10H15BO2/c1-2-3-4-9-5-7-10(8-6-9)11(12)13/h5-8,12-13H,2-4H2,1H3 |
CAS NO |
145240-28-4 |
Struktur Molekul |
|
Kepadatan |
1.03g/cm3 |
Titik lebur |
91-97℃ |
Titik didih |
313.5°C at 760 mmHg |
Indeks bias |
1.512 |
Titik nyala |
143.4°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|