ChemNet > CAS > 14804-31-0 Bromomethoxytoluene
14804-31-0 Bromomethoxytoluene
Nama produk |
Bromomethoxytoluene |
Sinonim |
5-Bromo-2-methoxytoluene; 4-Bromo-2-methylanisole; 4-bromo-1-methoxy-2-methylbenzene |
MF |
C8H9BrO |
Berat Molekul |
201.0605 |
InChI |
InChI=1/C8H9BrO/c1-6-5-7(9)3-4-8(6)10-2/h3-5H,1-2H3 |
CAS NO |
14804-31-0 |
Struktur Molekul |
|
Kepadatan |
1.378g/cm3 |
Titik lebur |
66-69℃ |
Titik didih |
226.1°C at 760 mmHg |
Indeks bias |
1.535 |
Titik nyala |
102.3°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|