ChemNet > CAS > 154607-01-9 4-Bromo-2-chlorobenzonitrile
154607-01-9 4-Bromo-2-chlorobenzonitrile
| Nama produk |
4-Bromo-2-chlorobenzonitrile |
| Sinonim |
2-Chloro-4-Bromobenzonitrile |
| MF |
C7H3BrClN |
| Berat Molekul |
216.4624 |
| InChI |
InChI=1/C7H3BrClN/c8-6-2-1-5(4-10)7(9)3-6/h1-3H |
| CAS NO |
154607-01-9 |
| Struktur Molekul |
|
| Kepadatan |
1.74g/cm3 |
| Titik didih |
279.8°C at 760 mmHg |
| Indeks bias |
1.623 |
| Titik nyala |
123°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
