ChemNet > CAS > 1638-22-8 p-butylphenol
1638-22-8 p-butylphenol
Nama produk |
p-butylphenol |
Sinonim |
4-n-Butylphenol; 4-butylphenol |
MF |
C10H14O |
Berat Molekul |
150.2176 |
InChI |
InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
CAS NO |
1638-22-8 |
EINECS |
216-672-5 |
Struktur Molekul |
|
Kepadatan |
0.977g/cm3 |
Titik didih |
246.2°C at 760 mmHg |
Indeks bias |
1.522 |
Titik nyala |
121.5°C |
Cinta bahaya |
|
Kod Risiko |
R34:Causes burns.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|