ChemNet > CAS > 16493-35-9 Undecyl methacrylate
16493-35-9 Undecyl methacrylate
| Nama produk |
Undecyl methacrylate |
| Sinonim |
2-Propenoic acid, 2-methyl-, undecyl ester; undecyl 2-methylprop-2-enoate |
| MF |
C15H28O2 |
| Berat Molekul |
240.3816 |
| InChI |
InChI=1/C15H28O2/c1-4-5-6-7-8-9-10-11-12-13-17-15(16)14(2)3/h2,4-13H2,1,3H3 |
| CAS NO |
16493-35-9 |
| EINECS |
240-558-4 |
| Struktur Molekul |
|
| Kepadatan |
0.875g/cm3 |
| Titik didih |
305.9°C at 760 mmHg |
| Indeks bias |
1.443 |
| Titik nyala |
124.4°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S28:After contact with skin, wash immediately with plenty of ...;
|
|
