ChemNet > CAS > 16689-02-4 5-Nitrothiophene-2-carbonitrile
16689-02-4 5-Nitrothiophene-2-carbonitrile
| Nama produk |
5-Nitrothiophene-2-carbonitrile |
| Sinonim |
2-Cyano-5-nitrothiophene |
| MF |
C5H2N2O2S |
| Berat Molekul |
154.1466 |
| InChI |
InChI=1/C5H2N2O2S/c6-3-4-1-2-5(10-4)7(8)9/h1-2H |
| CAS NO |
16689-02-4 |
| Struktur Molekul |
|
| Kepadatan |
1.5g/cm3 |
| Titik didih |
273.9°C at 760 mmHg |
| Indeks bias |
1.611 |
| Titik nyala |
119.4°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
