ChemNet > CAS > 175205-18-2 N-(4-propylphenyl)thiourea
175205-18-2 N-(4-propylphenyl)thiourea
Nama produk |
N-(4-propylphenyl)thiourea |
Sinonim |
1-(4-propylphenyl)thiourea |
MF |
C10H14N2S |
Berat Molekul |
194.2966 |
InChI |
InChI=1/C10H14N2S/c1-2-3-8-4-6-9(7-5-8)12-10(11)13/h4-7H,2-3H2,1H3,(H3,11,12,13) |
CAS NO |
175205-18-2 |
Struktur Molekul |
|
Kepadatan |
1.164g/cm3 |
Titik lebur |
165℃ |
Titik didih |
310°C at 760 mmHg |
Indeks bias |
1.65 |
Titik nyala |
141.3°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S37/39:Wear suitable gloves and eye/face protection.;
|
|