ChemNet > CAS > 1823-44-5 2-(2-Thiazolylazo)-p-cresol
1823-44-5 2-(2-Thiazolylazo)-p-cresol
| Nama produk |
2-(2-Thiazolylazo)-p-cresol |
| Sinonim |
TAC; 4-Methyl-2-(2-thiazolylazo)-phenol; 4-methyl-6-(1,3-thiazol-2-ylhydrazono)cyclohexa-2,4-dien-1-one; (6E)-4-methyl-6-[2-(1,3-thiazol-2-yl)hydrazinylidene]cyclohexa-2,4-dien-1-one |
| MF |
C10H9N3OS |
| Berat Molekul |
219.263 |
| InChI |
InChI=1/C10H9N3OS/c1-7-2-3-9(14)8(6-7)12-13-10-11-4-5-15-10/h2-6H,1H3,(H,11,13)/b12-8+ |
| CAS NO |
1823-44-5 |
| Struktur Molekul |
|
| Kepadatan |
1.357g/cm3 |
| Titik lebur |
127-130℃ |
| Titik didih |
464.649°C at 760 mmHg |
| Indeks bias |
1.681 |
| Titik nyala |
234.812°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
