ChemNet > CAS > 18355-75-4 2,3-difluorobenzamide
18355-75-4 2,3-difluorobenzamide
Nama produk |
2,3-difluorobenzamide |
Sinonim |
2,3-Difluorobenzamide |
MF |
C7H5F2NO |
Berat Molekul |
157.1175 |
InChI |
InChI=1/C7H5F2NO/c8-5-3-1-2-4(6(5)9)7(10)11/h1-3H,(H2,10,11) |
CAS NO |
18355-75-4 |
Struktur Molekul |
|
Kepadatan |
1.348g/cm3 |
Titik didih |
197°C at 760 mmHg |
Indeks bias |
1.515 |
Titik nyala |
73°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|