ChemNet > CAS > 18917-76-5 1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene
18917-76-5 1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene
Nama produk |
1,3-dimethoxy-5-(2-nitroprop-1-enyl)benzene |
Sinonim |
1-(3,5-Dimethoxyphenyl)-2-nitroprop-1-ene; 1,3-dimethoxy-5-(2-nitroprop-1-en-1-yl)benzene |
MF |
C11H13NO4 |
Berat Molekul |
223.2252 |
InChI |
InChI=1/C11H13NO4/c1-8(12(13)14)4-9-5-10(15-2)7-11(6-9)16-3/h4-7H,1-3H3 |
CAS NO |
18917-76-5 |
Struktur Molekul |
|
Kepadatan |
1.168g/cm3 |
Titik lebur |
87℃ |
Titik didih |
358°C at 760 mmHg |
Indeks bias |
1.555 |
Titik nyala |
159.4°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|