ChemNet > CAS > 18937-79-6 Methyl 2-hexynoate
18937-79-6 Methyl 2-hexynoate
Nama produk |
Methyl 2-hexynoate |
Sinonim |
2-Hexynoic acid methyl ester; methyl hex-2-ynoate |
MF |
C7H10O2 |
Berat Molekul |
126.1531 |
InChI |
InChI=1/C7H10O2/c1-3-4-5-6-7(8)9-2/h3-4H2,1-2H3 |
CAS NO |
18937-79-6 |
EINECS |
242-690-8 |
Struktur Molekul |
|
Kepadatan |
0.963g/cm3 |
Titik didih |
184.4°C at 760 mmHg |
Indeks bias |
1.436 |
Titik nyala |
65.4°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|