ChemNet > CAS > 19144-86-6 (S)-(-)-N-Acetyl-1-methylbenzylamine
19144-86-6 (S)-(-)-N-Acetyl-1-methylbenzylamine
Nama produk |
(S)-(-)-N-Acetyl-1-methylbenzylamine |
Sinonim |
(3beta)-3-hydroxycholest-5-en-22-one; N-[(1S)-1-phenylethyl]acetamide |
MF |
C10H13NO |
Berat Molekul |
163.2163 |
InChI |
InChI=1/C10H13NO/c1-8(11-9(2)12)10-6-4-3-5-7-10/h3-8H,1-2H3,(H,11,12)/t8-/m0/s1 |
CAS NO |
19144-86-6 |
Struktur Molekul |
|
Kepadatan |
1.007g/cm3 |
Titik lebur |
102℃ |
Titik didih |
327.9°C at 760 mmHg |
Indeks bias |
1.513 |
Titik nyala |
192.2°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|