ChemNet > CAS > 195209-93-9 Diisopropyl chloromalonate
195209-93-9 Diisopropyl chloromalonate
| Nama produk |
Diisopropyl chloromalonate |
| Sinonim |
Chloromalonic acid diisopropyl ester; bis(1-methylethyl) chloropropanedioate |
| MF |
C9H15ClO4 |
| Berat Molekul |
222.666 |
| InChI |
InChI=1/C9H15ClO4/c1-5(2)13-8(11)7(10)9(12)14-6(3)4/h5-7H,1-4H3 |
| CAS NO |
195209-93-9 |
| Struktur Molekul |
|
| Kepadatan |
1.132g/cm3 |
| Titik didih |
238.1°C at 760 mmHg |
| Indeks bias |
1.442 |
| Titik nyala |
83.3°C |
| Cinta bahaya |
|
| Kod Risiko |
R34:Causes burns.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
