ChemNet > CAS > 20028-53-9 2-Amino-5-chlorobenzaldehyde
20028-53-9 2-Amino-5-chlorobenzaldehyde
Nama produk |
2-Amino-5-chlorobenzaldehyde |
Sinonim |
6-Amino-3-chlorobenzaldehyde |
MF |
C7H6ClNO |
Berat Molekul |
155.5816 |
InChI |
InChI=1/C7H6ClNO/c8-6-1-2-7(9)5(3-6)4-10/h1-4H,9H2 |
CAS NO |
20028-53-9 |
Struktur Molekul |
|
Kepadatan |
1.348g/cm3 |
Titik didih |
288.1°C at 760 mmHg |
Indeks bias |
1.651 |
Titik nyala |
128°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|