ChemNet > CAS > 2005-08-5 4-chlorophenyl benzoate
2005-08-5 4-chlorophenyl benzoate
Nama produk |
4-chlorophenyl benzoate |
Sinonim |
4-Chlorophenyl benzoate; benzoic acid 4-chlorophenyl ester |
MF |
C13H9ClO2 |
Berat Molekul |
232.6624 |
InChI |
InChI=1/C13H9ClO2/c14-11-6-8-12(9-7-11)16-13(15)10-4-2-1-3-5-10/h1-9H |
CAS NO |
2005-08-5 |
EINECS |
217-910-0 |
Struktur Molekul |
|
Kepadatan |
1.258g/cm3 |
Titik lebur |
87-89℃ |
Titik didih |
343.1°C at 760 mmHg |
Indeks bias |
1.594 |
Titik nyala |
175.5°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|