ChemNet > CAS > 208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
208173-21-1 4-fluoro-2-(trifluoromethyl)acetophenone
| Nama produk |
4-fluoro-2-(trifluoromethyl)acetophenone |
| Sinonim |
4'-fluoro-2'-(trifluoromethyl)acetophenone; 1-[4-fluoro-2-(trifluoromethyl)phenyl]ethanone; 4'-Fluoro-2'-trifluoromethylacetophenone; 4-Fluoro-2-trifluoromethylacetophenone |
| MF |
C9H9FO2 |
| Berat Molekul |
168.165 |
| InChI |
InChI=1/C9H9FO2/c1-6(11)7-3-4-8(10)9(5-7)12-2/h3-5H,1-2H3 |
| CAS NO |
208173-21-1 |
| Struktur Molekul |
|
| Kepadatan |
1.127g/cm3 |
| Titik didih |
246°C at 760 mmHg |
| Indeks bias |
1.487 |
| Titik nyala |
99.6°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
