ChemNet > CAS > 208173-22-2 2,3,6-trifluoroacetophenone
208173-22-2 2,3,6-trifluoroacetophenone
Nama produk |
2,3,6-trifluoroacetophenone |
Sinonim |
2',3',6'-trifluoroacetophenone; 1-(2,3,6-trifluorophenyl)ethanone |
MF |
C8H5F3O |
Berat Molekul |
174.1199 |
InChI |
InChI=1/C8H5F3O/c1-4(12)7-5(9)2-3-6(10)8(7)11/h2-3H,1H3 |
CAS NO |
208173-22-2 |
Struktur Molekul |
|
Kepadatan |
1.303g/cm3 |
Titik didih |
187.2°C at 760 mmHg |
Indeks bias |
1.455 |
Titik nyala |
65°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|