ChemNet > CAS > 2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
2145-31-5 3-(trifluoromethyl)phenoxyacetonitrile
Nama produk |
3-(trifluoromethyl)phenoxyacetonitrile |
Sinonim |
2-[3-(Trifluoromethyl)phenoxy]acetonitrile; methyl 4-fluoro-3-hydroxybenzoate |
MF |
C8H7FO3 |
Berat Molekul |
170.1378 |
InChI |
InChI=1/C8H7FO3/c1-12-8(11)5-2-3-6(9)7(10)4-5/h2-4,10H,1H3 |
CAS NO |
2145-31-5 |
Struktur Molekul |
|
Kepadatan |
1.309g/cm3 |
Titik didih |
268.9°C at 760 mmHg |
Indeks bias |
1.526 |
Titik nyala |
116.4°C |
Cinta bahaya |
Xn:Harmful;
|
Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Keselamatan Penerangan |
S36/37:Wear suitable protective clothing and gloves.;
|
|