ChemNet > CAS > 21557-09-5 4-(1-Pyrrolidino)acetophenone
21557-09-5 4-(1-Pyrrolidino)acetophenone
Nama produk |
4-(1-Pyrrolidino)acetophenone |
Sinonim |
1-[4-(pyrrolidin-1-yl)phenyl]ethanone |
MF |
C12H15NO |
Berat Molekul |
189.2536 |
InChI |
InChI=1/C12H15NO/c1-10(14)11-4-6-12(7-5-11)13-8-2-3-9-13/h4-7H,2-3,8-9H2,1H3 |
CAS NO |
21557-09-5 |
Struktur Molekul |
|
Kepadatan |
1.078g/cm3 |
Titik didih |
342.7°C at 760 mmHg |
Indeks bias |
1.556 |
Titik nyala |
136.5°C |
Cinta bahaya |
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|