ChemNet > CAS > 21880-87-5 (S)-1,2,3,4-Tetrahydro-2-naphthylamine
21880-87-5 (S)-1,2,3,4-Tetrahydro-2-naphthylamine
| Nama produk |
(S)-1,2,3,4-Tetrahydro-2-naphthylamine |
| Sinonim |
(S)-2-Amino-1,2,3,4-tetrahydronaphthalene; (S)-1-Aminotetraline; (S)-2-Aminotetralin; (1S)-1,2,3,4-tetrahydronaphthalen-1-amine; (2S)-1,2,3,4-tetrahydronaphthalen-2-amine |
| MF |
C10H13N |
| Berat Molekul |
147.2169 |
| InChI |
InChI=1/C10H13N/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-4,10H,5-7,11H2/t10-/m0/s1 |
| CAS NO |
21880-87-5 |
| Struktur Molekul |
|
| Kepadatan |
1.024g/cm3 |
| Titik didih |
250.665°C at 760 mmHg |
| Indeks bias |
1.561 |
| Titik nyala |
111.607°C |
| Cinta bahaya |
|
| Kod Risiko |
R36/38:Irritating to eyes and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|
