ChemNet > CAS > 219492-12-3 3-(Benzyloxy)-4-methylphenylamine
219492-12-3 3-(Benzyloxy)-4-methylphenylamine
Nama produk |
3-(Benzyloxy)-4-methylphenylamine |
Sinonim |
3-(benzyloxy)-4-methylaniline |
MF |
C14H15NO |
Berat Molekul |
213.275 |
InChI |
InChI=1/C14H15NO/c1-11-7-8-13(15)9-14(11)16-10-12-5-3-2-4-6-12/h2-9H,10,15H2,1H3 |
CAS NO |
219492-12-3 |
Struktur Molekul |
|
Kepadatan |
1.106g/cm3 |
Titik didih |
369.3°C at 760 mmHg |
Indeks bias |
1.606 |
Titik nyala |
184.1°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|