ChemNet > CAS > 22225-77-0 2-(difluoromethoxy)nitrobenzene
22225-77-0 2-(difluoromethoxy)nitrobenzene
Nama produk |
2-(difluoromethoxy)nitrobenzene |
Sinonim |
1-(Difluoromethoxy)-2-nitrobenzene |
MF |
C7H5F2NO3 |
Berat Molekul |
189.1163 |
InChI |
InChI=1/C7H5F2NO3/c8-7(9)13-6-4-2-1-3-5(6)10(11)12/h1-4,7H |
CAS NO |
22225-77-0 |
Struktur Molekul |
|
Kepadatan |
1.384g/cm3 |
Titik didih |
249.4°C at 760 mmHg |
Indeks bias |
1.494 |
Titik nyala |
104.6°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|