ChemNet > CAS > 25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
25016-09-5 1,3-dimethyl-1H-pyrazole-5-carbaldehyde
| Nama produk |
1,3-dimethyl-1H-pyrazole-5-carbaldehyde |
| Sinonim |
1,3-Dimethylpyrazole-5-carbaldehyde; 2,5-dimethylpyrazole-3-carbaldehyde |
| MF |
C6H8N2O |
| Berat Molekul |
124.1405 |
| InChI |
InChI=1/C6H8N2O/c1-5-3-6(4-9)8(2)7-5/h3-4H,1-2H3 |
| CAS NO |
25016-09-5 |
| Struktur Molekul |
|
| Kepadatan |
1.114g/cm3 |
| Titik lebur |
40℃ |
| Titik didih |
227.739°C at 760 mmHg |
| Indeks bias |
1.543 |
| Titik nyala |
91.534°C |
| Cinta bahaya |
 Xi:Irritant;
|
| Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
