ChemNet > CAS > 25369-78-2 5-Chloro-2-mercaptobenzimidazole
25369-78-2 5-Chloro-2-mercaptobenzimidazole
| Nama produk |
5-Chloro-2-mercaptobenzimidazole |
| Sinonim |
5-Chlorobenzimidazole-2-thiol; 6-chloro-1H-benzimidazole-2-thiol |
| MF |
C7H5ClN2S |
| Berat Molekul |
184.646 |
| InChI |
InChI=1/C7H5ClN2S/c8-4-1-2-5-6(3-4)10-7(11)9-5/h1-3H,(H2,9,10,11) |
| CAS NO |
25369-78-2 |
| EINECS |
246-903-5 |
| Struktur Molekul |
|
| Kepadatan |
1.54g/cm3 |
| Titik lebur |
290-292℃ |
| Titik didih |
300.7°C at 760 mmHg |
| Indeks bias |
1.75 |
| Titik nyala |
135.6°C |
| Cinta bahaya |
 T:Toxic;
|
| Kod Risiko |
R25:Toxic if swallowed.;
|
| Keselamatan Penerangan |
S28A:After contact with skin, wash immediately with plenty of water.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
