ChemNet > CAS > 255724-71-1 5-Fluoro-2-iodoaniline
255724-71-1 5-Fluoro-2-iodoaniline
| Nama produk |
5-Fluoro-2-iodoaniline |
| MF |
C6H5FIN |
| Berat Molekul |
237.0135 |
| InChI |
InChI=1/C6H5FIN/c7-4-1-2-5(8)6(9)3-4/h1-3H,9H2 |
| CAS NO |
255724-71-1 |
| Struktur Molekul |
|
| Kepadatan |
2.008g/cm3 |
| Titik didih |
258.2°C at 760 mmHg |
| Indeks bias |
1.656 |
| Titik nyala |
110°C |
| Cinta bahaya |
|
| Kod Risiko |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Keselamatan Penerangan |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
