ChemNet > CAS > 266312-58-7 5-(2,4-dichlorophenyl)-4-(2-furylmethyl)-4H-1,2,4-triazole-3-thiol
266312-58-7 5-(2,4-dichlorophenyl)-4-(2-furylmethyl)-4H-1,2,4-triazole-3-thiol
Nama produk |
5-(2,4-dichlorophenyl)-4-(2-furylmethyl)-4H-1,2,4-triazole-3-thiol |
Sinonim |
5-(2,4-dichlorophenyl)-4-(furan-2-ylmethyl)-2,4-dihydro-3H-1,2,4-triazole-3-thione |
MF |
C13H9Cl2N3OS |
Berat Molekul |
326.2011 |
InChI |
InChI=1/C13H9Cl2N3OS/c14-8-3-4-10(11(15)6-8)12-16-17-13(20)18(12)7-9-2-1-5-19-9/h1-6H,7H2,(H,17,20) |
CAS NO |
266312-58-7 |
Struktur Molekul |
|
Kepadatan |
1.55g/cm3 |
Titik lebur |
158℃ |
Titik didih |
426.3°C at 760 mmHg |
Indeks bias |
1.716 |
Titik nyala |
211.6°C |
Cinta bahaya |
|
Kod Risiko |
|
Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|