ChemNet > CAS > 2783-17-7 1,12-diaminododecane
2783-17-7 1,12-diaminododecane
Nama produk |
1,12-diaminododecane |
Sinonim |
Diaminododecane; dodecamethylenediamine; 1,12-Dodecanediamine; 1,12-Dodecyl diamine; dodecane-1,12-diamine; dodecane-1,12-diaminium dichloride; dodecane-1,1-diamine |
MF |
C12H28N2 |
Berat Molekul |
200.3641 |
InChI |
InChI=1/C12H28N2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h12H,2-11,13-14H2,1H3 |
CAS NO |
2783-17-7 |
EINECS |
220-489-6 |
Struktur Molekul |
|
Kepadatan |
0.855g/cm3 |
Titik lebur |
69-71℃ |
Titik didih |
283.84°C at 760 mmHg |
Indeks bias |
1.464 |
Titik nyala |
155.577°C |
Cinta bahaya |
|
Kod Risiko |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|