ChemNet > CAS > 287917-97-9 4-bromo-1H-pyrazole-5-carbaldehyde
287917-97-9 4-bromo-1H-pyrazole-5-carbaldehyde
Nama produk |
4-bromo-1H-pyrazole-5-carbaldehyde |
MF |
C4H3BrN2O |
Berat Molekul |
174.9834 |
InChI |
InChI=1/C4H3BrN2O/c5-3-1-6-7-4(3)2-8/h1-2H,(H,6,7) |
CAS NO |
287917-97-9 |
Struktur Molekul |
|
Kepadatan |
1.969g/cm3 |
Titik lebur |
178℃ |
Titik didih |
338.3°C at 760 mmHg |
Indeks bias |
1.67 |
Titik nyala |
158.4°C |
Cinta bahaya |
Xi:Irritant;
|
Kod Risiko |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Keselamatan Penerangan |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|